C10H15ClN4 — CID 118730393
2-(5,6,7,8-tetrahydroquinolin-3-yl)guanidine;hydrochloride (PubChem CID 118730393) has the molecular formula C10H15ClN4 and a molecular weight of 226.71 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydroquinolin-3-yl)guanidine;hydrochloride.
| Compound Name | 2-(5,6,7,8-tetrahydroquinolin-3-yl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 118730393 |
| Molecular Formula | C10H15ClN4 |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-(5,6,7,8-tetrahydroquinolin-3-yl)guanidine;hydrochloride |
| SMILES | Cl.NC(N)=Nc1cnc2c(c1)CCCC2 |
| InChI | InChI=1S/C10H14N4.ClH/c11-10(12)14-8-5-7-3-1-2-4-9(7)13-6-8;/h5-6H,1-4H2,(H4,11,12,14);1H |
| InChIKey | OKARPRUVRCNIIG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|