About N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride
N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride (PubChem CID 118730397) has the molecular formula C8H11ClN4
and a molecular weight of 198.66 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride |
| PubChem CID | 118730397 |
| Molecular Formula | C8H11ClN4 |
| Molecular Weight | 198.66 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride |
| SMILES | Cl.c1ccc(NC2=NCCN2)nc1 |
| InChI | InChI=1S/C8H10N4.ClH/c1-2-4-9-7(3-1)12-8-10-5-6-11-8;/h1-4H,5-6H2,(H2,9,10,11,12);1H |
| InChIKey | HBGYJZIOZIGTJK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.66 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride (CID 118730397) is N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride is Cl.c1ccc(NC2=NCCN2)nc1.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride?
The InChIKey is HBGYJZIOZIGTJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4.ClH/c1-2-4-9-7(3-1)12-8-10-5-6-11-8;/h1-4H,5-6H2,(H2,9,10,11,12);1H.
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride?
N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride has a molecular weight of 198.66 g/mol, XLogP of 0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride is sourced from PubChem (CID 118730397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).