About 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride
5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride (PubChem CID 118730398) has the molecular formula C8H10Cl2N4
and a molecular weight of 233.10 g/mol. Its IUPAC name is 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride |
| PubChem CID | 118730398 |
| Molecular Formula | C8H10Cl2N4 |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride |
| SMILES | Cl.Clc1ccc(NC2=NCCN2)nc1 |
| InChI | InChI=1S/C8H9ClN4.ClH/c9-6-1-2-7(12-5-6)13-8-10-3-4-11-8;/h1-2,5H,3-4H2,(H2,10,11,12,13);1H |
| InChIKey | WTDFAIHZDDJUTJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride?
The IUPAC name of 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride (CID 118730398) is 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride.
What is the SMILES notation for 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride?
The canonical SMILES for 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride is Cl.Clc1ccc(NC2=NCCN2)nc1.
What is the InChIKey of 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride?
The InChIKey is WTDFAIHZDDJUTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN4.ClH/c9-6-1-2-7(12-5-6)13-8-10-3-4-11-8;/h1-2,5H,3-4H2,(H2,10,11,12,13);1H.
What are the key properties of 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride?
5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride has a molecular weight of 233.10 g/mol, XLogP of 1.53, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)pyridin-2-amine;hydrochloride is sourced from PubChem (CID 118730398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).