C48H62N2O8 — CID 118730447
(2S,3S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-methyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]pentanamide (PubChem CID 118730447) has the molecular formula C48H62N2O8 and a molecular weight of 795.03 g/mol. Its IUPAC name is (2S,3S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-methyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]pentanamide.
| Compound Name | (2S,3S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-methyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]pentanamide |
|---|---|
| PubChem CID | 118730447 |
| Molecular Formula | C48H62N2O8 |
| Molecular Weight | 795.03 g/mol |
| Exact Mass | 794.45 |
| IUPAC Name | (2S,3S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-methyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]pentanamide |
| SMILES | CC[C@H](C)[C@H](NCCC1OCC(C)(C)CO1)C(=O)N[C@H]1[C@@H](OCc2ccccc2)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C48H62N2O8/c1-5-35(2)42(49-27-26-41-56-33-48(3,4)34-57-41)46(51)50-43-45(54-30-38-22-14-8-15-23-38)44(53-29-37-20-12-7-13-21-37)40(32-52-28-36-18-10-6-11-19-36)58-47(43)55-31-39-24-16-9-17-25-39/h6-25,35,40-45,47,49H,5,26-34H2,1-4H3,(H,50,51)/t35-,40+,42-,43+,44+,45+,47-/m0/s1 |
| InChIKey | TXDSELLUSHYUEA-IWDANULGSA-N |
| XLogP | 7.59 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.03 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |