C51H60N2O8 — CID 118730448
(2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-phenyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]propanamide (PubChem CID 118730448) has the molecular formula C51H60N2O8 and a molecular weight of 829.05 g/mol. Its IUPAC name is (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-phenyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]propanamide.
| Compound Name | (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-phenyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]propanamide |
|---|---|
| PubChem CID | 118730448 |
| Molecular Formula | C51H60N2O8 |
| Molecular Weight | 829.05 g/mol |
| Exact Mass | 828.43 |
| IUPAC Name | (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-phenyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]propanamide |
| SMILES | CC1(C)COC(CCN[C@@H](Cc2ccccc2)C(=O)N[C@H]2[C@@H](OCc3ccccc3)O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)OC1 |
| InChI | InChI=1S/C51H60N2O8/c1-51(2)36-59-45(60-37-51)28-29-52-43(30-38-18-8-3-9-19-38)49(54)53-46-48(57-33-41-24-14-6-15-25-41)47(56-32-40-22-12-5-13-23-40)44(35-55-31-39-20-10-4-11-21-39)61-50(46)58-34-42-26-16-7-17-27-42/h3-27,43-48,50,52H,28-37H2,1-2H3,(H,53,54)/t43-,44+,46+,47+,48+,50-/m0/s1 |
| InChIKey | VPJJFCDPNYFEEX-FZOMCIHHSA-N |
| XLogP | 7.79 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.05 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |