C47H60N2O8 — CID 118730449
(2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-methyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]butanamide (PubChem CID 118730449) has the molecular formula C47H60N2O8 and a molecular weight of 781.00 g/mol. Its IUPAC name is (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-methyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]butanamide.
| Compound Name | (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-methyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]butanamide |
|---|---|
| PubChem CID | 118730449 |
| Molecular Formula | C47H60N2O8 |
| Molecular Weight | 781.00 g/mol |
| Exact Mass | 780.43 |
| IUPAC Name | (2S)-2-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethylamino]-3-methyl-N-[(2S,3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]butanamide |
| SMILES | CC(C)[C@H](NCCC1OCC(C)(C)CO1)C(=O)N[C@H]1[C@@H](OCc2ccccc2)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C47H60N2O8/c1-34(2)41(48-26-25-40-55-32-47(3,4)33-56-40)45(50)49-42-44(53-29-37-21-13-7-14-22-37)43(52-28-36-19-11-6-12-20-36)39(31-51-27-35-17-9-5-10-18-35)57-46(42)54-30-38-23-15-8-16-24-38/h5-24,34,39-44,46,48H,25-33H2,1-4H3,(H,49,50)/t39-,41+,42-,43-,44-,46+/m1/s1 |
| InChIKey | WZNWAPHFFZMFIA-NZTUAYMSSA-N |
| XLogP | 7.20 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.00 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |