C16H22 — CID 118730783
(4aS,9aR)-7-ethynyl-4a,9a-dimethyl-4-methylidene-1,2,3,5,8,9-hexahydrobenzo[7]annulene (PubChem CID 118730783) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is (4aS,9aR)-7-ethynyl-4a,9a-dimethyl-4-methylidene-1,2,3,5,8,9-hexahydrobenzo[7]annulene.
| Compound Name | (4aS,9aR)-7-ethynyl-4a,9a-dimethyl-4-methylidene-1,2,3,5,8,9-hexahydrobenzo[7]annulene |
|---|---|
| PubChem CID | 118730783 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (4aS,9aR)-7-ethynyl-4a,9a-dimethyl-4-methylidene-1,2,3,5,8,9-hexahydrobenzo[7]annulene |
| SMILES | C#CC1=CC[C@@]2(C)C(=C)CCC[C@]2(C)CC1 |
| InChI | InChI=1S/C16H22/c1-5-14-8-11-15(3)10-6-7-13(2)16(15,4)12-9-14/h1,9H,2,6-8,10-12H2,3-4H3/t15-,16+/m1/s1 |
| InChIKey | SFJIIRQBFLVPSN-CVEARBPZSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|