C11H11Cl3N4OS — CID 118731002
N-[4-[(E)-N-(carbamothioylamino)-C-methylcarbonimidoyl]phenyl]-2,2,2-trichloroacetamide (PubChem CID 118731002) has the molecular formula C11H11Cl3N4OS and a molecular weight of 353.66 g/mol. Its IUPAC name is N-[4-[(E)-N-(carbamothioylamino)-C-methylcarbonimidoyl]phenyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[4-[(E)-N-(carbamothioylamino)-C-methylcarbonimidoyl]phenyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 118731002 |
| Molecular Formula | C11H11Cl3N4OS |
| Molecular Weight | 353.66 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | N-[4-[(E)-N-(carbamothioylamino)-C-methylcarbonimidoyl]phenyl]-2,2,2-trichloroacetamide |
| SMILES | C/C(=N\NC(N)=S)c1ccc(NC(=O)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C11H11Cl3N4OS/c1-6(17-18-10(15)20)7-2-4-8(5-3-7)16-9(19)11(12,13)14/h2-5H,1H3,(H,16,19)(H3,15,18,20)/b17-6+ |
| InChIKey | AOVLZRQEHKJDKL-UBKPWBPPSA-N |
| XLogP | 2.55 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.66 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|