C15H8F2N4S — CID 118731163
12-(2,4-difluorophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 118731163) has the molecular formula C15H8F2N4S and a molecular weight of 314.32 g/mol. Its IUPAC name is 12-(2,4-difluorophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | 12-(2,4-difluorophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 118731163 |
| Molecular Formula | C15H8F2N4S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 12-(2,4-difluorophenyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | Nc1ncnc2c1sc1ncc(-c3ccc(F)cc3F)cc12 |
| InChI | InChI=1S/C15H8F2N4S/c16-8-1-2-9(11(17)4-8)7-3-10-12-13(14(18)21-6-20-12)22-15(10)19-5-7/h1-6H,(H2,18,20,21) |
| InChIKey | GAMSOECPTUHWGO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |