C16H10N4O2S — CID 118731169
12-(1,3-benzodioxol-5-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 118731169) has the molecular formula C16H10N4O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is 12-(1,3-benzodioxol-5-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | 12-(1,3-benzodioxol-5-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 118731169 |
| Molecular Formula | C16H10N4O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 12-(1,3-benzodioxol-5-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | Nc1ncnc2c1sc1ncc(-c3ccc4c(c3)OCO4)cc12 |
| InChI | InChI=1S/C16H10N4O2S/c17-15-14-13(19-6-20-15)10-3-9(5-18-16(10)23-14)8-1-2-11-12(4-8)22-7-21-11/h1-6H,7H2,(H2,17,19,20) |
| InChIKey | XRBJGODILDBFFI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |