C13H8N4S2 — CID 118731170
12-thiophen-2-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 118731170) has the molecular formula C13H8N4S2 and a molecular weight of 284.37 g/mol. Its IUPAC name is 12-thiophen-2-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | 12-thiophen-2-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 118731170 |
| Molecular Formula | C13H8N4S2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 12-thiophen-2-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | Nc1ncnc2c1sc1ncc(-c3cccs3)cc12 |
| InChI | InChI=1S/C13H8N4S2/c14-12-11-10(16-6-17-12)8-4-7(5-15-13(8)19-11)9-2-1-3-18-9/h1-6H,(H2,14,16,17) |
| InChIKey | XYQWUYOWUDHLCC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |