C24H36NO3+ — CID 11873118
(3R,3aS,5aS,9bS)-5a,9-dimethyl-3-[[(5S)-3,3,5-trimethylazepan-1-ium-1-yl]methyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione (PubChem CID 11873118) has the molecular formula C24H36NO3+ and a molecular weight of 386.56 g/mol. Its IUPAC name is (3R,3aS,5aS,9bS)-5a,9-dimethyl-3-[[(5S)-3,3,5-trimethylazepan-1-ium-1-yl]methyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione.
| Compound Name | (3R,3aS,5aS,9bS)-5a,9-dimethyl-3-[[(5S)-3,3,5-trimethylazepan-1-ium-1-yl]methyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 11873118 |
| Molecular Formula | C24H36NO3+ |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (3R,3aS,5aS,9bS)-5a,9-dimethyl-3-[[(5S)-3,3,5-trimethylazepan-1-ium-1-yl]methyl]-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
| SMILES | CC1=C2[C@H]3OC(=O)[C@@H](C[NH+]4CC[C@@H](C)CC(C)(C)C4)[C@@H]3CC[C@@]2(C)C=CC1=O |
| InChI | InChI=1S/C24H35NO3/c1-15-8-11-25(14-23(3,4)12-15)13-18-17-6-9-24(5)10-7-19(26)16(2)20(24)21(17)28-22(18)27/h7,10,15,17-18,21H,6,8-9,11-14H2,1-5H3/p+1/t15-,17+,18+,21+,24+/m1/s1 |
| InChIKey | ZKHQMBPYBVPJKV-AJLIQWHYSA-O |
| XLogP | 2.74 |
| TPSA | 47.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |