C19H25FN2O — CID 118731302
(4S)-N,N-diethyl-9-(2-fluoroethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide (PubChem CID 118731302) has the molecular formula C19H25FN2O and a molecular weight of 316.42 g/mol. Its IUPAC name is (4S)-N,N-diethyl-9-(2-fluoroethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide.
| Compound Name | (4S)-N,N-diethyl-9-(2-fluoroethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide |
|---|---|
| PubChem CID | 118731302 |
| Molecular Formula | C19H25FN2O |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (4S)-N,N-diethyl-9-(2-fluoroethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1CCCc2c1c1ccccc1n2CCF |
| InChI | InChI=1S/C19H25FN2O/c1-3-21(4-2)19(23)15-9-7-11-17-18(15)14-8-5-6-10-16(14)22(17)13-12-20/h5-6,8,10,15H,3-4,7,9,11-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | XICRODIMJLZTJP-HNNXBMFYSA-N |
| XLogP | 3.90 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|