C20H20N4O — CID 118731445
11-[3-(dimethylamino)propyl]-11,13,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,9,12(17),13,15-octaen-8-one (PubChem CID 118731445) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is 11-[3-(dimethylamino)propyl]-11,13,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,9,12(17),13,15-octaen-8-one.
| Compound Name | 11-[3-(dimethylamino)propyl]-11,13,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,9,12(17),13,15-octaen-8-one |
|---|---|
| PubChem CID | 118731445 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 11-[3-(dimethylamino)propyl]-11,13,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,9,12(17),13,15-octaen-8-one |
| SMILES | CN(C)CCCn1c2cc(=O)c3ccccc3c-2nc2cccnc21 |
| InChI | InChI=1S/C20H20N4O/c1-23(2)11-6-12-24-17-13-18(25)14-7-3-4-8-15(14)19(17)22-16-9-5-10-21-20(16)24/h3-5,7-10,13H,6,11-12H2,1-2H3 |
| InChIKey | BCCJYJLLBKSSBU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|