About 6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one
6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one (PubChem CID 118731579) has the molecular formula C18H17BrN2O2
and a molecular weight of 373.25 g/mol. Its IUPAC name is 6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one |
| PubChem CID | 118731579 |
| Molecular Formula | C18H17BrN2O2 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2cc(Br)ccc2n1CCCN1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H17BrN2O2/c19-15-6-7-16-17(10-15)23-18(22)21(16)9-3-8-20-11-13-4-1-2-5-14(13)12-20/h1-2,4-7,10H,3,8-9,11-12H2 |
| InChIKey | IDCBZHVQOHYLGK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one?
The IUPAC name of 6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one (CID 118731579) is 6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one.
What is the SMILES notation for 6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one?
The canonical SMILES for 6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one is O=c1oc2cc(Br)ccc2n1CCCN1Cc2ccccc2C1.
What is the InChIKey of 6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one?
The InChIKey is IDCBZHVQOHYLGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BrN2O2/c19-15-6-7-16-17(10-15)23-18(22)21(16)9-3-8-20-11-13-4-1-2-5-14(13)12-20/h1-2,4-7,10H,3,8-9,11-12H2.
What are the key properties of 6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one?
6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one has a molecular weight of 373.25 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-[3-(1,3-dihydroisoindol-2-yl)propyl]-1,3-benzoxazol-2-one is sourced from PubChem (CID 118731579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).