C20H19ClFN5O4 — CID 118731594
4-chloro-2-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]benzamide (PubChem CID 118731594) has the molecular formula C20H19ClFN5O4 and a molecular weight of 447.85 g/mol. Its IUPAC name is 4-chloro-2-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]benzamide.
| Compound Name | 4-chloro-2-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 118731594 |
| Molecular Formula | C20H19ClFN5O4 |
| Molecular Weight | 447.85 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 4-chloro-2-[[5-fluoro-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]amino]benzamide |
| SMILES | COc1cc(Nc2ncc(F)c(Nc3cc(Cl)ccc3C(N)=O)n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H19ClFN5O4/c1-29-15-7-11(8-16(30-2)17(15)31-3)25-20-24-9-13(22)19(27-20)26-14-6-10(21)4-5-12(14)18(23)28/h4-9H,1-3H3,(H2,23,28)(H2,24,25,26,27) |
| InChIKey | BEOUFDUDVWXYGM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.85 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |