C27H32N2O3S — CID 118731719
3-[(2Z)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]propane-1-sulfonate (PubChem CID 118731719) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is 3-[(2Z)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]propane-1-sulfonate.
| Compound Name | 3-[(2Z)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 118731719 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 3-[(2Z)-3,3-dimethyl-2-[(E)-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indol-1-yl]propane-1-sulfonate |
| SMILES | C[N+]1=C(/C=C/C=C2\N(CCCS(=O)(=O)[O-])c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C27H32N2O3S/c1-26(2)20-12-6-8-14-22(20)28(5)24(26)16-10-17-25-27(3,4)21-13-7-9-15-23(21)29(25)18-11-19-33(30,31)32/h6-10,12-17H,11,18-19H2,1-5H3 |
| InChIKey | AVXULDQQWFVQOG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|