C25H27Br2IN2S2 — CID 118731737
(2Z)-6-bromo-2-[(E)-3-(6-bromo-3-butyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-butyl-1,3-benzothiazole iodide (PubChem CID 118731737) has the molecular formula C25H27Br2IN2S2 and a molecular weight of 706.35 g/mol. Its IUPAC name is (2Z)-6-bromo-2-[(E)-3-(6-bromo-3-butyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-butyl-1,3-benzothiazole iodide.
| Compound Name | (2Z)-6-bromo-2-[(E)-3-(6-bromo-3-butyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-butyl-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 118731737 |
| Molecular Formula | C25H27Br2IN2S2 |
| Molecular Weight | 706.35 g/mol |
| Exact Mass | 703.90 |
| IUPAC Name | (2Z)-6-bromo-2-[(E)-3-(6-bromo-3-butyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3-butyl-1,3-benzothiazole iodide |
| SMILES | CCCCN1/C(=C/C=C/c2sc3cc(Br)ccc3[n+]2CCCC)Sc2cc(Br)ccc21.[I-] |
| InChI | InChI=1S/C25H27Br2N2S2.HI/c1-3-5-14-28-20-12-10-18(26)16-22(20)30-24(28)8-7-9-25-29(15-6-4-2)21-13-11-19(27)17-23(21)31-25;/h7-13,16-17H,3-6,14-15H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | KYKMLRFOVANWFW-UHFFFAOYSA-M |
| XLogP | 5.78 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.35 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|