C33H40Br3IN2 — CID 118731746
(2E)-5-bromo-2-[(2Z,4E)-3-bromo-5-(5-bromo-1-butyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-1-butyl-3,3-dimethylindole iodide (PubChem CID 118731746) has the molecular formula C33H40Br3IN2 and a molecular weight of 831.31 g/mol. Its IUPAC name is (2E)-5-bromo-2-[(2Z,4E)-3-bromo-5-(5-bromo-1-butyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-1-butyl-3,3-dimethylindole iodide.
| Compound Name | (2E)-5-bromo-2-[(2Z,4E)-3-bromo-5-(5-bromo-1-butyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-1-butyl-3,3-dimethylindole iodide |
|---|---|
| PubChem CID | 118731746 |
| Molecular Formula | C33H40Br3IN2 |
| Molecular Weight | 831.31 g/mol |
| Exact Mass | 827.98 |
| IUPAC Name | (2E)-5-bromo-2-[(2Z,4E)-3-bromo-5-(5-bromo-1-butyl-3,3-dimethylindol-1-ium-2-yl)penta-2,4-dienylidene]-1-butyl-3,3-dimethylindole iodide |
| SMILES | CCCCN1/C(=C/C=C(Br)/C=C/C2=[N+](CCCC)c3ccc(Br)cc3C2(C)C)C(C)(C)c2cc(Br)ccc21.[I-] |
| InChI | InChI=1S/C33H40Br3N2.HI/c1-7-9-19-37-28-15-11-24(35)21-26(28)32(3,4)30(37)17-13-23(34)14-18-31-33(5,6)27-22-25(36)12-16-29(27)38(31)20-10-8-2;/h11-18,21-22H,7-10,19-20H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | LLDCJQQWMKMDPX-UHFFFAOYSA-M |
| XLogP | 7.71 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.31 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|