C51H51IN2 — CID 118731751
(2E)-2-[(2E,4E)-5-[1,1-dimethyl-3-(3-phenylpropyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethyl-3-(3-phenylpropyl)benzo[e]indole iodide (PubChem CID 118731751) has the molecular formula C51H51IN2 and a molecular weight of 818.89 g/mol. Its IUPAC name is (2E)-2-[(2E,4E)-5-[1,1-dimethyl-3-(3-phenylpropyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethyl-3-(3-phenylpropyl)benzo[e]indole iodide.
| Compound Name | (2E)-2-[(2E,4E)-5-[1,1-dimethyl-3-(3-phenylpropyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethyl-3-(3-phenylpropyl)benzo[e]indole iodide |
|---|---|
| PubChem CID | 118731751 |
| Molecular Formula | C51H51IN2 |
| Molecular Weight | 818.89 g/mol |
| Exact Mass | 818.31 |
| IUPAC Name | (2E)-2-[(2E,4E)-5-[1,1-dimethyl-3-(3-phenylpropyl)benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethyl-3-(3-phenylpropyl)benzo[e]indole iodide |
| SMILES | CC1(C)C(/C=C/C=C/C=C2/N(CCCc3ccccc3)c3ccc4ccccc4c3C2(C)C)=[N+](CCCc2ccccc2)c2ccc3ccccc3c21.[I-] |
| InChI | InChI=1S/C51H51N2.HI/c1-50(2)46(52(36-18-24-38-20-8-5-9-21-38)44-34-32-40-26-14-16-28-42(40)48(44)50)30-12-7-13-31-47-51(3,4)49-43-29-17-15-27-41(43)33-35-45(49)53(47)37-19-25-39-22-10-6-11-23-39;/h5-17,20-23,26-35H,18-19,24-25,36-37H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | GMBNPLDQWFNLIH-UHFFFAOYSA-M |
| XLogP | 9.43 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.89 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|