C22H36NO3+ — CID 11873177
(1S,3R,4R,5S,8R,10R,14S)-5-[(3,3-dimethylpiperidin-1-ium-1-yl)methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one (PubChem CID 11873177) has the molecular formula C22H36NO3+ and a molecular weight of 362.53 g/mol. Its IUPAC name is (1S,3R,4R,5S,8R,10R,14S)-5-[(3,3-dimethylpiperidin-1-ium-1-yl)methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one.
| Compound Name | (1S,3R,4R,5S,8R,10R,14S)-5-[(3,3-dimethylpiperidin-1-ium-1-yl)methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
|---|---|
| PubChem CID | 11873177 |
| Molecular Formula | C22H36NO3+ |
| Molecular Weight | 362.53 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | (1S,3R,4R,5S,8R,10R,14S)-5-[(3,3-dimethylpiperidin-1-ium-1-yl)methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
| SMILES | C[C@H]1CCC[C@]2(C)C[C@H]3OC(=O)[C@H](C[NH+]4CCCC(C)(C)C4)[C@H]3[C@H]3O[C@@]312 |
| InChI | InChI=1S/C22H35NO3/c1-14-7-5-9-21(4)11-16-17(18-22(14,21)26-18)15(19(24)25-16)12-23-10-6-8-20(2,3)13-23/h14-18H,5-13H2,1-4H3/p+1/t14-,15+,16+,17+,18+,21+,22+/m0/s1 |
| InChIKey | AWARIKSVYAKVLG-XETSRNHHSA-O |
| XLogP | 2.22 |
| TPSA | 43.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|