C21H21NO3 — CID 118731770
1-[(3S,4R)-3-(hydroxymethyl)-4-phenylmethoxy-3,4-dihydro-1H-isoquinolin-2-yl]but-2-yn-1-one (PubChem CID 118731770) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-[(3S,4R)-3-(hydroxymethyl)-4-phenylmethoxy-3,4-dihydro-1H-isoquinolin-2-yl]but-2-yn-1-one.
| Compound Name | 1-[(3S,4R)-3-(hydroxymethyl)-4-phenylmethoxy-3,4-dihydro-1H-isoquinolin-2-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 118731770 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 1-[(3S,4R)-3-(hydroxymethyl)-4-phenylmethoxy-3,4-dihydro-1H-isoquinolin-2-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1Cc2ccccc2[C@@H](OCc2ccccc2)[C@@H]1CO |
| InChI | InChI=1S/C21H21NO3/c1-2-8-20(24)22-13-17-11-6-7-12-18(17)21(19(22)14-23)25-15-16-9-4-3-5-10-16/h3-7,9-12,19,21,23H,13-15H2,1H3/t19-,21+/m0/s1 |
| InChIKey | CFGGLYUMZFUPCF-PZJWPPBQSA-N |
| XLogP | 2.67 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|