C31H44O5 — CID 118731944
methyl (4R,4aR,6aR,6bS,8aR,11R,12S,12aR,14aR,14bR)-2-hydroxy-4,6a,6b,8a,11,12,14b-heptamethyl-3,14-dioxo-5,6,7,8,9,10,11,12,12a,14a-decahydro-4aH-picene-4-carboxylate (PubChem CID 118731944) has the molecular formula C31H44O5 and a molecular weight of 496.69 g/mol. Its IUPAC name is methyl (4R,4aR,6aR,6bS,8aR,11R,12S,12aR,14aR,14bR)-2-hydroxy-4,6a,6b,8a,11,12,14b-heptamethyl-3,14-dioxo-5,6,7,8,9,10,11,12,12a,14a-decahydro-4aH-picene-4-carboxylate.
| Compound Name | methyl (4R,4aR,6aR,6bS,8aR,11R,12S,12aR,14aR,14bR)-2-hydroxy-4,6a,6b,8a,11,12,14b-heptamethyl-3,14-dioxo-5,6,7,8,9,10,11,12,12a,14a-decahydro-4aH-picene-4-carboxylate |
|---|---|
| PubChem CID | 118731944 |
| Molecular Formula | C31H44O5 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | methyl (4R,4aR,6aR,6bS,8aR,11R,12S,12aR,14aR,14bR)-2-hydroxy-4,6a,6b,8a,11,12,14b-heptamethyl-3,14-dioxo-5,6,7,8,9,10,11,12,12a,14a-decahydro-4aH-picene-4-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C(=O)C(O)=C[C@]2(C)[C@H]3C(=O)C=C4[C@@H]5[C@@H](C)[C@H](C)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C31H44O5/c1-17-9-11-27(3)13-14-29(5)19(23(27)18(17)2)15-20(32)24-28(4)16-21(33)25(34)31(7,26(35)36-8)22(28)10-12-30(24,29)6/h15-18,22-24,33H,9-14H2,1-8H3/t17-,18+,22-,23+,24-,27-,28+,29-,30-,31-/m1/s1 |
| InChIKey | NQFAVZLJJQCNRX-XWNJIUHMSA-N |
| XLogP | 6.23 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|