C29H25F5N4O3 — CID 118732190
(2R,3R)-2-(3,4-difluorophenyl)-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-(3,3,3-trifluoropropyl)butanediamide (PubChem CID 118732190) has the molecular formula C29H25F5N4O3 and a molecular weight of 572.53 g/mol. Its IUPAC name is (2R,3R)-2-(3,4-difluorophenyl)-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-(3,3,3-trifluoropropyl)butanediamide.
| Compound Name | (2R,3R)-2-(3,4-difluorophenyl)-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-(3,3,3-trifluoropropyl)butanediamide |
|---|---|
| PubChem CID | 118732190 |
| Molecular Formula | C29H25F5N4O3 |
| Molecular Weight | 572.53 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | (2R,3R)-2-(3,4-difluorophenyl)-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-3-(3,3,3-trifluoropropyl)butanediamide |
| SMILES | CN1C(=O)[C@@H](NC(=O)[C@H](CCC(F)(F)F)[C@@H](C(N)=O)c2ccc(F)c(F)c2)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C29H25F5N4O3/c1-38-22-10-6-5-9-18(22)24(16-7-3-2-4-8-16)36-26(28(38)41)37-27(40)19(13-14-29(32,33)34)23(25(35)39)17-11-12-20(30)21(31)15-17/h2-12,15,19,23,26H,13-14H2,1H3,(H2,35,39)(H,37,40)/t19-,23+,26-/m1/s1 |
| InChIKey | AXDPFPZUTDRTAU-FRPAHBMMSA-N |
| XLogP | 4.45 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |