C26H28F2N6O — CID 118732262
N-[1-[(2,4-difluorophenyl)methyl]piperidin-4-yl]-7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine (PubChem CID 118732262) has the molecular formula C26H28F2N6O and a molecular weight of 478.55 g/mol. Its IUPAC name is N-[1-[(2,4-difluorophenyl)methyl]piperidin-4-yl]-7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-[1-[(2,4-difluorophenyl)methyl]piperidin-4-yl]-7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 118732262 |
| Molecular Formula | C26H28F2N6O |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | N-[1-[(2,4-difluorophenyl)methyl]piperidin-4-yl]-7-(2,4,6-trimethylphenoxy)-[1,2,4]triazolo[1,5-a]pyrimidin-5-amine |
| SMILES | Cc1cc(C)c(Oc2cc(NC3CCN(Cc4ccc(F)cc4F)CC3)nc3ncnn23)c(C)c1 |
| InChI | InChI=1S/C26H28F2N6O/c1-16-10-17(2)25(18(3)11-16)35-24-13-23(32-26-29-15-30-34(24)26)31-21-6-8-33(9-7-21)14-19-4-5-20(27)12-22(19)28/h4-5,10-13,15,21H,6-9,14H2,1-3H3,(H,29,30,31,32) |
| InChIKey | XWEBOFDUHCKGPZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |