C31H64N4+4 — CID 118732354
1-heptyl-4-[5-(4-heptyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)pentyl]-1,4-diazoniabicyclo[2.2.2]octane (PubChem CID 118732354) has the molecular formula C31H64N4+4 and a molecular weight of 492.88 g/mol. Its IUPAC name is 1-heptyl-4-[5-(4-heptyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)pentyl]-1,4-diazoniabicyclo[2.2.2]octane.
| Compound Name | 1-heptyl-4-[5-(4-heptyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)pentyl]-1,4-diazoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 118732354 |
| Molecular Formula | C31H64N4+4 |
| Molecular Weight | 492.88 g/mol |
| Exact Mass | 492.51 |
| IUPAC Name | 1-heptyl-4-[5-(4-heptyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)pentyl]-1,4-diazoniabicyclo[2.2.2]octane |
| SMILES | CCCCCCC[N+]12CC[N+](CCCCC[N+]34CC[N+](CCCCCCC)(CC3)CC4)(CC1)CC2 |
| InChI | InChI=1S/C31H64N4/c1-3-5-7-9-12-16-32-20-26-34(27-21-32,28-22-32)18-14-11-15-19-35-29-23-33(24-30-35,25-31-35)17-13-10-8-6-4-2/h3-31H2,1-2H3/q+4 |
| InChIKey | MTSSCJRCPJQNBA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.88 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|