C23H17ClN4O — CID 118732409
10-[(1-benzyltriazol-4-yl)methyl]-2-chloroacridin-9-one (PubChem CID 118732409) has the molecular formula C23H17ClN4O and a molecular weight of 400.87 g/mol. Its IUPAC name is 10-[(1-benzyltriazol-4-yl)methyl]-2-chloroacridin-9-one.
| Compound Name | 10-[(1-benzyltriazol-4-yl)methyl]-2-chloroacridin-9-one |
|---|---|
| PubChem CID | 118732409 |
| Molecular Formula | C23H17ClN4O |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 10-[(1-benzyltriazol-4-yl)methyl]-2-chloroacridin-9-one |
| SMILES | O=c1c2ccccc2n(Cc2cn(Cc3ccccc3)nn2)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H17ClN4O/c24-17-10-11-22-20(12-17)23(29)19-8-4-5-9-21(19)28(22)15-18-14-27(26-25-18)13-16-6-2-1-3-7-16/h1-12,14H,13,15H2 |
| InChIKey | WVVHZEXMIBRDPT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|