About ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate
ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate (PubChem CID 118732507) has the molecular formula C18H24N2O2S
and a molecular weight of 332.47 g/mol. Its IUPAC name is ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate |
| PubChem CID | 118732507 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(Nc2ccc(C)c(C)c2)nc1C(C)(C)C |
| InChI | InChI=1S/C18H24N2O2S/c1-7-22-16(21)14-15(18(4,5)6)20-17(23-14)19-13-9-8-11(2)12(3)10-13/h8-10H,7H2,1-6H3,(H,19,20) |
| InChIKey | YCXOBSINVSWEQJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate?
The IUPAC name of ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate (CID 118732507) is ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate.
What is the SMILES notation for ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate?
The canonical SMILES for ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate is CCOC(=O)c1sc(Nc2ccc(C)c(C)c2)nc1C(C)(C)C.
What is the InChIKey of ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate?
The InChIKey is YCXOBSINVSWEQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O2S/c1-7-22-16(21)14-15(18(4,5)6)20-17(23-14)19-13-9-8-11(2)12(3)10-13/h8-10H,7H2,1-6H3,(H,19,20).
What are the key properties of ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate?
ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate has a molecular weight of 332.47 g/mol, XLogP of 4.98, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-tert-butyl-2-(3,4-dimethylanilino)-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 118732507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).