About ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate
ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 118732524) has the molecular formula C25H20F2N2O3S
and a molecular weight of 466.51 g/mol. Its IUPAC name is ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 118732524 |
| Molecular Formula | C25H20F2N2O3S |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(Nc2c(F)cc(-c3cccc(OC)c3)cc2F)nc1-c1ccccc1 |
| InChI | InChI=1S/C25H20F2N2O3S/c1-3-32-24(30)23-21(15-8-5-4-6-9-15)28-25(33-23)29-22-19(26)13-17(14-20(22)27)16-10-7-11-18(12-16)31-2/h4-14H,3H2,1-2H3,(H,28,29) |
| InChIKey | XGHPILKTRRHOFN-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate?
The IUPAC name of ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate (CID 118732524) is ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate is CCOC(=O)c1sc(Nc2c(F)cc(-c3cccc(OC)c3)cc2F)nc1-c1ccccc1.
What is the InChIKey of ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate?
The InChIKey is XGHPILKTRRHOFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20F2N2O3S/c1-3-32-24(30)23-21(15-8-5-4-6-9-15)28-25(33-23)29-22-19(26)13-17(14-20(22)27)16-10-7-11-18(12-16)31-2/h4-14H,3H2,1-2H3,(H,28,29).
What are the key properties of ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate?
ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate has a molecular weight of 466.51 g/mol, XLogP of 6.68, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2,6-difluoro-4-(3-methoxyphenyl)anilino]-4-phenyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 118732524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).