C11H11N7O2S2 — CID 118732582
5-[(1-phenyltriazol-4-yl)methylamino]-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 118732582) has the molecular formula C11H11N7O2S2 and a molecular weight of 337.39 g/mol. Its IUPAC name is 5-[(1-phenyltriazol-4-yl)methylamino]-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-[(1-phenyltriazol-4-yl)methylamino]-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 118732582 |
| Molecular Formula | C11H11N7O2S2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 5-[(1-phenyltriazol-4-yl)methylamino]-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nnc(NCc2cn(-c3ccccc3)nn2)s1 |
| InChI | InChI=1S/C11H11N7O2S2/c12-22(19,20)11-16-15-10(21-11)13-6-8-7-18(17-14-8)9-4-2-1-3-5-9/h1-5,7H,6H2,(H,13,15)(H2,12,19,20) |
| InChIKey | QYHSRIMBIKVIKO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 128.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |