About cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride
cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride (PubChem CID 118732676) has the molecular formula C12H15ClF3NO
and a molecular weight of 281.71 g/mol. Its IUPAC name is cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride |
| PubChem CID | 118732676 |
| Molecular Formula | C12H15ClF3NO |
| Molecular Weight | 281.71 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride |
| SMILES | CC[C@]1(N)C[C@@H]1c1ccc(OC(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C12H14F3NO.ClH/c1-2-11(16)7-10(11)8-3-5-9(6-4-8)17-12(13,14)15;/h3-6,10H,2,7,16H2,1H3;1H/t10-,11+;/m1./s1 |
| InChIKey | OIVOGNGBKMUQJW-DHXVBOOMSA-N |
| XLogP | 3.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride?
The IUPAC name of cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride (CID 118732676) is cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride.
What is the SMILES notation for cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride?
The canonical SMILES for cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride is CC[C@]1(N)C[C@@H]1c1ccc(OC(F)(F)F)cc1.Cl.
What is the InChIKey of cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride?
The InChIKey is OIVOGNGBKMUQJW-DHXVBOOMSA-N. The full InChI is InChI=1S/C12H14F3NO.ClH/c1-2-11(16)7-10(11)8-3-5-9(6-4-8)17-12(13,14)15;/h3-6,10H,2,7,16H2,1H3;1H/t10-,11+;/m1./s1.
What are the key properties of cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride?
cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride has a molecular weight of 281.71 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-1-ethyl-2-[4-(trifluoromethoxy)phenyl]cyclopropan-1-amine;hydrochloride is sourced from PubChem (CID 118732676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).