C21H24O5 — CID 118732755
(1E,2S)-6-methoxy-1-[(3,4,5-trimethoxyphenyl)methylidene]-3,4-dihydro-2H-naphthalen-2-ol (PubChem CID 118732755) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (1E,2S)-6-methoxy-1-[(3,4,5-trimethoxyphenyl)methylidene]-3,4-dihydro-2H-naphthalen-2-ol.
| Compound Name | (1E,2S)-6-methoxy-1-[(3,4,5-trimethoxyphenyl)methylidene]-3,4-dihydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 118732755 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (1E,2S)-6-methoxy-1-[(3,4,5-trimethoxyphenyl)methylidene]-3,4-dihydro-2H-naphthalen-2-ol |
| SMILES | COc1ccc2c(c1)CC[C@H](O)/C2=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H24O5/c1-23-15-6-7-16-14(12-15)5-8-18(22)17(16)9-13-10-19(24-2)21(26-4)20(11-13)25-3/h6-7,9-12,18,22H,5,8H2,1-4H3/b17-9+/t18-/m0/s1 |
| InChIKey | ZMFSGTZTXVKBCT-GONKEYIRSA-N |
| XLogP | 3.57 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|