C21H25NO5 — CID 118732761
(1E,2S)-1-[(3-amino-4-methoxyphenyl)methylidene]-5,6,7-trimethoxy-3,4-dihydro-2H-naphthalen-2-ol (PubChem CID 118732761) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is (1E,2S)-1-[(3-amino-4-methoxyphenyl)methylidene]-5,6,7-trimethoxy-3,4-dihydro-2H-naphthalen-2-ol.
| Compound Name | (1E,2S)-1-[(3-amino-4-methoxyphenyl)methylidene]-5,6,7-trimethoxy-3,4-dihydro-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 118732761 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (1E,2S)-1-[(3-amino-4-methoxyphenyl)methylidene]-5,6,7-trimethoxy-3,4-dihydro-2H-naphthalen-2-ol |
| SMILES | COc1ccc(/C=C2\c3cc(OC)c(OC)c(OC)c3CC[C@@H]2O)cc1N |
| InChI | InChI=1S/C21H25NO5/c1-24-18-8-5-12(10-16(18)22)9-15-14-11-19(25-2)21(27-4)20(26-3)13(14)6-7-17(15)23/h5,8-11,17,23H,6-7,22H2,1-4H3/b15-9+/t17-/m0/s1 |
| InChIKey | NEFWEYATTUMQJQ-FVLHSZHDSA-N |
| XLogP | 3.15 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|