C12H12F2N2OS — CID 118732790
(4aS,7aS)-7a-(2,4-difluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine (PubChem CID 118732790) has the molecular formula C12H12F2N2OS and a molecular weight of 270.30 g/mol. Its IUPAC name is (4aS,7aS)-7a-(2,4-difluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aS,7aS)-7a-(2,4-difluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 118732790 |
| Molecular Formula | C12H12F2N2OS |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | (4aS,7aS)-7a-(2,4-difluorophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3ccc(F)cc3F)COC[C@H]2CS1 |
| InChI | InChI=1S/C12H12F2N2OS/c13-8-1-2-9(10(14)3-8)12-6-17-4-7(12)5-18-11(15)16-12/h1-3,7H,4-6H2,(H2,15,16)/t7-,12-/m0/s1 |
| InChIKey | PKKALIJXXMXWQH-MADCSZMMSA-N |
| XLogP | 1.87 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |