C15H18F2N2OS — CID 118732791
(4aR,6S,8aS)-8a-(2,4-difluorophenyl)-6-ethyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 118732791) has the molecular formula C15H18F2N2OS and a molecular weight of 312.38 g/mol. Its IUPAC name is (4aR,6S,8aS)-8a-(2,4-difluorophenyl)-6-ethyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,6S,8aS)-8a-(2,4-difluorophenyl)-6-ethyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 118732791 |
| Molecular Formula | C15H18F2N2OS |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (4aR,6S,8aS)-8a-(2,4-difluorophenyl)-6-ethyl-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | CC[C@H]1C[C@H]2CSC(N)=N[C@@]2(c2ccc(F)cc2F)CO1 |
| InChI | InChI=1S/C15H18F2N2OS/c1-2-11-5-9-7-21-14(18)19-15(9,8-20-11)12-4-3-10(16)6-13(12)17/h3-4,6,9,11H,2,5,7-8H2,1H3,(H2,18,19)/t9-,11-,15-/m0/s1 |
| InChIKey | LLMQRTLFGJQYQQ-ZSGNIPIJSA-N |
| XLogP | 3.04 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |