About (2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride
(2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride (PubChem CID 118732904) has the molecular formula C9H17ClN2OS
and a molecular weight of 236.77 g/mol. Its IUPAC name is (2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride |
| PubChem CID | 118732904 |
| Molecular Formula | C9H17ClN2OS |
| Molecular Weight | 236.77 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride |
| SMILES | CC[C@@H]1SC2(CCNCC2)NC1=O.Cl |
| InChI | InChI=1S/C9H16N2OS.ClH/c1-2-7-8(12)11-9(13-7)3-5-10-6-4-9;/h7,10H,2-6H2,1H3,(H,11,12);1H/t7-;/m0./s1 |
| InChIKey | PFFGTKWYBYROQF-FJXQXJEOSA-N |
| XLogP | 1.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.77 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride?
The IUPAC name of (2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride (CID 118732904) is (2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride.
What is the SMILES notation for (2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride?
The canonical SMILES for (2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride is CC[C@@H]1SC2(CCNCC2)NC1=O.Cl.
What is the InChIKey of (2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride?
The InChIKey is PFFGTKWYBYROQF-FJXQXJEOSA-N. The full InChI is InChI=1S/C9H16N2OS.ClH/c1-2-7-8(12)11-9(13-7)3-5-10-6-4-9;/h7,10H,2-6H2,1H3,(H,11,12);1H/t7-;/m0./s1.
What are the key properties of (2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride?
(2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride has a molecular weight of 236.77 g/mol, XLogP of 1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-ethyl-1-thia-4,8-diazaspiro[4.5]decan-3-one;hydrochloride is sourced from PubChem (CID 118732904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).