About 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide
4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide (PubChem CID 118732927) has the molecular formula C22H18N2O5S
and a molecular weight of 422.46 g/mol. Its IUPAC name is 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide |
| PubChem CID | 118732927 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2ccc(Cc3ccc4c(c3)CC(=O)N(O)C4=O)cc2)cc1 |
| InChI | InChI=1S/C22H18N2O5S/c23-30(28,29)19-8-6-17(7-9-19)16-4-1-14(2-5-16)11-15-3-10-20-18(12-15)13-21(25)24(27)22(20)26/h1-10,12,27H,11,13H2,(H2,23,28,29) |
| InChIKey | GUEVYQFBVKIPJZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide?
The IUPAC name of 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide (CID 118732927) is 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide.
What is the SMILES notation for 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide?
The canonical SMILES for 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide is NS(=O)(=O)c1ccc(-c2ccc(Cc3ccc4c(c3)CC(=O)N(O)C4=O)cc2)cc1.
What is the InChIKey of 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide?
The InChIKey is GUEVYQFBVKIPJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O5S/c23-30(28,29)19-8-6-17(7-9-19)16-4-1-14(2-5-16)11-15-3-10-20-18(12-15)13-21(25)24(27)22(20)26/h1-10,12,27H,11,13H2,(H2,23,28,29).
What are the key properties of 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide?
4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide has a molecular weight of 422.46 g/mol, XLogP of 2.51, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2-hydroxy-1,3-dioxo-4H-isoquinolin-6-yl)methyl]phenyl]benzenesulfonamide is sourced from PubChem (CID 118732927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).