C18H10F3N5O3 — CID 118733085
N-(4-nitrophenyl)-8-(2,4,6-trifluorophenoxy)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 118733085) has the molecular formula C18H10F3N5O3 and a molecular weight of 401.30 g/mol. Its IUPAC name is N-(4-nitrophenyl)-8-(2,4,6-trifluorophenoxy)imidazo[1,2-a]pyrazin-6-amine.
| Compound Name | N-(4-nitrophenyl)-8-(2,4,6-trifluorophenoxy)imidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 118733085 |
| Molecular Formula | C18H10F3N5O3 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-(4-nitrophenyl)-8-(2,4,6-trifluorophenoxy)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | O=[N+]([O-])c1ccc(Nc2cn3ccnc3c(Oc3c(F)cc(F)cc3F)n2)cc1 |
| InChI | InChI=1S/C18H10F3N5O3/c19-10-7-13(20)16(14(21)8-10)29-18-17-22-5-6-25(17)9-15(24-18)23-11-1-3-12(4-2-11)26(27)28/h1-9,23H |
| InChIKey | CLGFHAUOERUFIV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|