C37H42N4O6S — CID 118733191
[4-[[3-[1-(3,5-dimethyladamantane-1-carbonyl)piperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate (PubChem CID 118733191) has the molecular formula C37H42N4O6S and a molecular weight of 670.83 g/mol. Its IUPAC name is [4-[[3-[1-(3,5-dimethyladamantane-1-carbonyl)piperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate.
| Compound Name | [4-[[3-[1-(3,5-dimethyladamantane-1-carbonyl)piperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate |
|---|---|
| PubChem CID | 118733191 |
| Molecular Formula | C37H42N4O6S |
| Molecular Weight | 670.83 g/mol |
| Exact Mass | 670.28 |
| IUPAC Name | [4-[[3-[1-(3,5-dimethyladamantane-1-carbonyl)piperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)N1CCC(N4C(=O)NC(=O)C4Cc4ccc(OS(=O)(=O)c5cccc6cnccc56)cc4)CC1)(C3)C2 |
| InChI | InChI=1S/C37H42N4O6S/c1-35-17-25-18-36(2,21-35)23-37(19-25,22-35)33(43)40-14-11-27(12-15-40)41-30(32(42)39-34(41)44)16-24-6-8-28(9-7-24)47-48(45,46)31-5-3-4-26-20-38-13-10-29(26)31/h3-10,13,20,25,27,30H,11-12,14-19,21-23H2,1-2H3,(H,39,42,44) |
| InChIKey | FIZNFIIDAJNQID-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.83 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|