About 2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium
2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium (PubChem CID 118733365) has the molecular formula C22H23NO5
and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium.
Molecular Properties
| Compound Name | 2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium |
| PubChem CID | 118733365 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium |
| SMILES | C#CC[NH+](C)CC(=C)c1cccc(COc2ccccc2)c1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C20H21NO.C2H2O4/c1-4-13-21(3)15-17(2)19-10-8-9-18(14-19)16-22-20-11-6-5-7-12-20;3-1(4)2(5)6/h1,5-12,14H,2,13,15-16H2,3H3;(H,3,4)(H,5,6) |
| InChIKey | BOXGDCDSPNFKRU-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium?
The IUPAC name of 2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium (CID 118733365) is 2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium.
What is the SMILES notation for 2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium?
The canonical SMILES for 2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium is C#CC[NH+](C)CC(=C)c1cccc(COc2ccccc2)c1.O=C([O-])C(=O)O.
What is the InChIKey of 2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium?
The InChIKey is BOXGDCDSPNFKRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO.C2H2O4/c1-4-13-21(3)15-17(2)19-10-8-9-18(14-19)16-22-20-11-6-5-7-12-20;3-1(4)2(5)6/h1,5-12,14H,2,13,15-16H2,3H3;(H,3,4)(H,5,6).
What are the key properties of 2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium?
2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium has a molecular weight of 381.43 g/mol, XLogP of 0.25, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-oxoacetate;methyl-[2-[3-(phenoxymethyl)phenyl]prop-2-enyl]-prop-2-ynylazanium is sourced from PubChem (CID 118733365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).