C22H32O4 — CID 118733407
[3-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-5-oxo-2H-furan-2-yl] acetate (PubChem CID 118733407) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [3-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-5-oxo-2H-furan-2-yl] acetate.
| Compound Name | [3-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-5-oxo-2H-furan-2-yl] acetate |
|---|---|
| PubChem CID | 118733407 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [3-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-5-oxo-2H-furan-2-yl] acetate |
| SMILES | CC(=O)OC1OC(=O)C=C1CC[C@@]1(C)[C@H](C)CC[C@@]2(C)C(C)=CCC[C@H]12 |
| InChI | InChI=1S/C22H32O4/c1-14-7-6-8-18-21(14,4)11-9-15(2)22(18,5)12-10-17-13-19(24)26-20(17)25-16(3)23/h7,13,15,18,20H,6,8-12H2,1-5H3/t15-,18+,20?,21+,22+/m1/s1 |
| InChIKey | RUWAXMSQGBJERD-DNDIUFHKSA-N |
| XLogP | 4.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|