C25H22FNO4 — CID 118733591
ethyl (2Z,5E)-6-[1-[(4-fluorophenyl)methyl]-4-phenylpyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate (PubChem CID 118733591) has the molecular formula C25H22FNO4 and a molecular weight of 419.45 g/mol. Its IUPAC name is ethyl (2Z,5E)-6-[1-[(4-fluorophenyl)methyl]-4-phenylpyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate.
| Compound Name | ethyl (2Z,5E)-6-[1-[(4-fluorophenyl)methyl]-4-phenylpyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate |
|---|---|
| PubChem CID | 118733591 |
| Molecular Formula | C25H22FNO4 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | ethyl (2Z,5E)-6-[1-[(4-fluorophenyl)methyl]-4-phenylpyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate |
| SMILES | CCOC(=O)/C(O)=C/C(=O)/C=C/c1cc(-c2ccccc2)cn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H22FNO4/c1-2-31-25(30)24(29)15-23(28)13-12-22-14-20(19-6-4-3-5-7-19)17-27(22)16-18-8-10-21(26)11-9-18/h3-15,17,29H,2,16H2,1H3/b13-12+,24-15- |
| InChIKey | FMQUECSPXGHIFM-MWIIGANGSA-N |
| XLogP | 4.93 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|