C24H18FNO5 — CID 118733599
(2Z,5E)-6-[1-benzyl-4-(4-fluorobenzoyl)pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid (PubChem CID 118733599) has the molecular formula C24H18FNO5 and a molecular weight of 419.41 g/mol. Its IUPAC name is (2Z,5E)-6-[1-benzyl-4-(4-fluorobenzoyl)pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid.
| Compound Name | (2Z,5E)-6-[1-benzyl-4-(4-fluorobenzoyl)pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 118733599 |
| Molecular Formula | C24H18FNO5 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (2Z,5E)-6-[1-benzyl-4-(4-fluorobenzoyl)pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid |
| SMILES | O=C(/C=C(\O)C(=O)O)/C=C/c1cc(C(=O)c2ccc(F)cc2)cn1Cc1ccccc1 |
| InChI | InChI=1S/C24H18FNO5/c25-19-8-6-17(7-9-19)23(29)18-12-20(10-11-21(27)13-22(28)24(30)31)26(15-18)14-16-4-2-1-3-5-16/h1-13,15,28H,14H2,(H,30,31)/b11-10+,22-13- |
| InChIKey | VQPMBYHMQIXPFU-SNOGGGIRSA-N |
| XLogP | 4.02 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|