C23H18FNO4 — CID 118733601
(2Z,5E)-6-[1-[(4-fluorophenyl)methyl]-4-phenylpyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid (PubChem CID 118733601) has the molecular formula C23H18FNO4 and a molecular weight of 391.40 g/mol. Its IUPAC name is (2Z,5E)-6-[1-[(4-fluorophenyl)methyl]-4-phenylpyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid.
| Compound Name | (2Z,5E)-6-[1-[(4-fluorophenyl)methyl]-4-phenylpyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 118733601 |
| Molecular Formula | C23H18FNO4 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (2Z,5E)-6-[1-[(4-fluorophenyl)methyl]-4-phenylpyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid |
| SMILES | O=C(/C=C(\O)C(=O)O)/C=C/c1cc(-c2ccccc2)cn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H18FNO4/c24-19-8-6-16(7-9-19)14-25-15-18(17-4-2-1-3-5-17)12-20(25)10-11-21(26)13-22(27)23(28)29/h1-13,15,27H,14H2,(H,28,29)/b11-10+,22-13- |
| InChIKey | ZKXLYZRRHRYSKC-SNOGGGIRSA-N |
| XLogP | 4.45 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|