About [(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride
[(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride (PubChem CID 118733763) has the molecular formula C13H19Cl2NO
and a molecular weight of 276.21 g/mol. Its IUPAC name is [(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride |
| PubChem CID | 118733763 |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | [(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride |
| SMILES | CCCOc1ccc(Cl)cc1[C@@H]1C[C@H]1CN.Cl |
| InChI | InChI=1S/C13H18ClNO.ClH/c1-2-5-16-13-4-3-10(14)7-12(13)11-6-9(11)8-15;/h3-4,7,9,11H,2,5-6,8,15H2,1H3;1H/t9-,11+;/m0./s1 |
| InChIKey | BBPBCCGVAHHOPE-QLSWKGBWSA-N |
| XLogP | 3.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride?
The IUPAC name of [(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride (CID 118733763) is [(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride.
What is the SMILES notation for [(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride?
The canonical SMILES for [(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride is CCCOc1ccc(Cl)cc1[C@@H]1C[C@H]1CN.Cl.
What is the InChIKey of [(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride?
The InChIKey is BBPBCCGVAHHOPE-QLSWKGBWSA-N. The full InChI is InChI=1S/C13H18ClNO.ClH/c1-2-5-16-13-4-3-10(14)7-12(13)11-6-9(11)8-15;/h3-4,7,9,11H,2,5-6,8,15H2,1H3;1H/t9-,11+;/m0./s1.
What are the key properties of [(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride?
[(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride has a molecular weight of 276.21 g/mol, XLogP of 3.61, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-(5-chloro-2-propoxyphenyl)cyclopropyl]methanamine;hydrochloride is sourced from PubChem (CID 118733763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).