C16H21ClF3NO3 — CID 118733767
[(1R,2R)-2-(2-butoxy-5-chlorophenyl)cyclopropyl]methanamine;2,2,2-trifluoroacetic acid (PubChem CID 118733767) has the molecular formula C16H21ClF3NO3 and a molecular weight of 367.80 g/mol. Its IUPAC name is [(1R,2R)-2-(2-butoxy-5-chlorophenyl)cyclopropyl]methanamine;2,2,2-trifluoroacetic acid.
| Compound Name | [(1R,2R)-2-(2-butoxy-5-chlorophenyl)cyclopropyl]methanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118733767 |
| Molecular Formula | C16H21ClF3NO3 |
| Molecular Weight | 367.80 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [(1R,2R)-2-(2-butoxy-5-chlorophenyl)cyclopropyl]methanamine;2,2,2-trifluoroacetic acid |
| SMILES | CCCCOc1ccc(Cl)cc1[C@@H]1C[C@H]1CN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H20ClNO.C2HF3O2/c1-2-3-6-17-14-5-4-11(15)8-13(14)12-7-10(12)9-16;3-2(4,5)1(6)7/h4-5,8,10,12H,2-3,6-7,9,16H2,1H3;(H,6,7)/t10-,12+;/m0./s1 |
| InChIKey | HAXZYNFZRUJQBN-XOZOLZJESA-N |
| XLogP | 4.21 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.80 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|