About [(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine
[(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine (PubChem CID 118733820) has the molecular formula C13H16FNO
and a molecular weight of 221.27 g/mol. Its IUPAC name is [(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine.
Molecular Properties
| Compound Name | [(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine |
| PubChem CID | 118733820 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | [(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine |
| SMILES | C=CCOc1ccc(F)cc1[C@@H]1C[C@H]1CN |
| InChI | InChI=1S/C13H16FNO/c1-2-5-16-13-4-3-10(14)7-12(13)11-6-9(11)8-15/h2-4,7,9,11H,1,5-6,8,15H2/t9-,11+/m0/s1 |
| InChIKey | FZUHWKBXUCCYPI-GXSJLCMTSA-N |
| XLogP | 2.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine?
The IUPAC name of [(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine (CID 118733820) is [(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine.
What is the SMILES notation for [(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine?
The canonical SMILES for [(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine is C=CCOc1ccc(F)cc1[C@@H]1C[C@H]1CN.
What is the InChIKey of [(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine?
The InChIKey is FZUHWKBXUCCYPI-GXSJLCMTSA-N. The full InChI is InChI=1S/C13H16FNO/c1-2-5-16-13-4-3-10(14)7-12(13)11-6-9(11)8-15/h2-4,7,9,11H,1,5-6,8,15H2/t9-,11+/m0/s1.
What are the key properties of [(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine?
[(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine has a molecular weight of 221.27 g/mol, XLogP of 2.45, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-(5-fluoro-2-prop-2-enoxyphenyl)cyclopropyl]methanamine is sourced from PubChem (CID 118733820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).