C28H36O4 — CID 118733830
[(5R,7R,8R,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl] benzoate (PubChem CID 118733830) has the molecular formula C28H36O4 and a molecular weight of 436.59 g/mol. Its IUPAC name is [(5R,7R,8R,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl] benzoate.
| Compound Name | [(5R,7R,8R,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl] benzoate |
|---|---|
| PubChem CID | 118733830 |
| Molecular Formula | C28H36O4 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | [(5R,7R,8R,9S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-7-yl] benzoate |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3[C@H](OC(=O)c4ccccc4)C[C@@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H36O4/c1-17(29)21-9-10-22-25-23(12-14-28(21,22)3)27(2)13-11-20(30)15-19(27)16-24(25)32-26(31)18-7-5-4-6-8-18/h4-8,19,21-25H,9-16H2,1-3H3/t19-,21+,22-,23-,24+,25-,27-,28+/m0/s1 |
| InChIKey | LEPIWHXQAAOQMX-IZKRTJEZSA-N |
| XLogP | 5.64 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |