C17H22O4 — CID 118733912
3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-5-methoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 118733912) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-5-methoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-5-methoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 118733912 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-5-methoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=CC(=O)C(O)=C(C/C=C(\C)CCC=C(C)C)C1=O |
| InChI | InChI=1S/C17H22O4/c1-11(2)6-5-7-12(3)8-9-13-16(19)14(18)10-15(21-4)17(13)20/h6,8,10,19H,5,7,9H2,1-4H3/b12-8+ |
| InChIKey | MDUHETMFMHWBIR-XYOKQWHBSA-N |
| XLogP | 3.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|