C18H24O4 — CID 118734014
3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-dimethoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 118734014) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-dimethoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-dimethoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 118734014 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-dimethoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=CC(=O)C(OC)=C(C/C=C(\C)CCC=C(C)C)C1=O |
| InChI | InChI=1S/C18H24O4/c1-12(2)7-6-8-13(3)9-10-14-17(20)16(21-4)11-15(19)18(14)22-5/h7,9,11H,6,8,10H2,1-5H3/b13-9+ |
| InChIKey | XBUWLUAEMXJNFP-UKTHLTGXSA-N |
| XLogP | 3.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|